CymitQuimica logo

CAS 88561-47-1

:

2,6-Pyridinedicarboxamide, 4-(dimethylamino)-N,N'-dimethyl-

Description:
2,6-Pyridinedicarboxamide, 4-(dimethylamino)-N,N'-dimethyl- is a chemical compound characterized by its pyridine ring structure, which is substituted with two carboxamide groups at the 2 and 6 positions and a dimethylamino group at the 4 position. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential hydrogen bonding capabilities due to the presence of the amide functional groups. The dimethylamino group contributes to its basicity and may influence its reactivity and interaction with other chemical species. The presence of multiple functional groups suggests that it could participate in various chemical reactions, including nucleophilic substitutions and potential coordination with metal ions. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its specific applications and behavior in different environments would depend on the context of its use, including concentration, pH, and the presence of other reactants.
Formula:C11H16N4O2
InChI:InChI=1S/C11H16N4O2/c1-12-10(16)8-5-7(15(3)4)6-9(14-8)11(17)13-2/h5-6H,1-4H3,(H,12,16)(H,13,17)
InChI key:QYXAMQZWIFHUNP-UHFFFAOYSA-N
SMILES:CNC(=O)C1=CC(=CC(=N1)C(=O)NC)N(C)C
Found 1 products.