CymitQuimica logo

CAS 88561-50-6

:

2,6-Pyridinedicarboxamide, N,N'-dimethyl-4-[(phenylmethyl)amino]-

Description:
2,6-Pyridinedicarboxamide, N,N'-dimethyl-4-[(phenylmethyl)amino]- is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with two carboxamide groups and a dimethylamino group. The presence of the phenylmethylamino moiety adds to its molecular complexity, contributing to its potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxamide functional groups. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. The compound may also display specific properties such as stability under certain conditions, and its reactivity can be influenced by the functional groups present. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its potential toxicity and environmental impact. Further studies would be necessary to fully elucidate its properties and applications in various fields.
Formula:C16H18N4O2
InChI:InChI=1S/C16H18N4O2/c1-17-15(21)13-8-12(9-14(20-13)16(22)18-2)19-10-11-6-4-3-5-7-11/h3-9H,10H2,1-2H3,(H,17,21)(H,18,22)(H,19,20)
InChI key:NEMYPVKWWHNNQT-UHFFFAOYSA-N
SMILES:CNC(=O)C1=CC(=CC(=N1)C(=O)NC)NCC2=CC=CC=C2
Found 1 products.