CAS 88561-80-2
:1,3,4-Oxadiazole, 2-[4-(4-ethylcyclohexyl)phenyl]-5-propyl-
Description:
1,3,4-Oxadiazole, 2-[4-(4-ethylcyclohexyl)phenyl]-5-propyl- is a heterocyclic organic compound characterized by the presence of an oxadiazole ring, which consists of two nitrogen atoms and three carbon atoms in its five-membered structure. This compound features a phenyl group substituted with a 4-ethylcyclohexyl moiety and a propyl group, contributing to its unique physical and chemical properties. Typically, oxadiazoles exhibit interesting biological activities and can serve as intermediates in the synthesis of pharmaceuticals and agrochemicals. The presence of bulky substituents like the ethylcyclohexyl group may influence the compound's solubility, melting point, and reactivity. Additionally, the compound's structure suggests potential applications in materials science, particularly in the development of organic semiconductors or light-emitting devices. As with many organic compounds, the specific characteristics such as boiling point, melting point, and solubility would depend on the molecular interactions and the overall molecular structure. Safety data and handling precautions should be consulted due to the potential hazards associated with chemical substances.
Formula:C19H26N2O
InChI:InChI=1S/C19H26N2O/c1-3-5-18-20-21-19(22-18)17-12-10-16(11-13-17)15-8-6-14(4-2)7-9-15/h10-15H,3-9H2,1-2H3
InChI key:RTAMGTGJEYLVFU-UHFFFAOYSA-N
SMILES:CCCC1=NN=C(O1)C2=CC=C(C=C2)C3CCC(CC3)CC
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1,3,4-Oxadiazole, 2-[4-(4-ethylcyclohexyl)phenyl]-5-propyl-
CAS:Formula:C19H26N2OMolecular weight:298.4225
