CymitQuimica logo

CAS 88562-02-1

:

1H-Indazole-3-acetic acid, 5-chloro-, octyl ester

Description:
1H-Indazole-3-acetic acid, 5-chloro-, octyl ester is an organic compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a chloro substituent at the 5-position of the indazole ring contributes to its chemical reactivity and potential biological activity. The octyl ester group indicates that the compound has an octyl chain attached to the carboxylic acid moiety, which can influence its solubility and lipophilicity, making it more suitable for various applications, including pharmaceuticals and agrochemicals. This compound may exhibit specific interactions with biological targets due to its structural features, and its ester functionality suggests it could undergo hydrolysis to release the active acid form. Overall, the characteristics of this compound, including its molecular structure, functional groups, and potential applications, make it a subject of interest in chemical research and development.
Formula:C17H23ClN2O2
InChI:InChI=1S/C17H23ClN2O2/c1-2-3-4-5-6-7-10-22-17(21)12-16-14-11-13(18)8-9-15(14)19-20-16/h8-9,11H,2-7,10,12H2,1H3,(H,19,20)
InChI key:CWKWCTSHNHPQOJ-UHFFFAOYSA-N
SMILES:CCCCCCCCOC(=O)CC1=C2C=C(C=CC2=NN1)Cl
Found 1 products.