CAS 88562-10-1
:1,3-Cyclohexanedione, 2-(2-iodobenzoyl)-
Description:
1,3-Cyclohexanedione, 2-(2-iodobenzoyl)-, with the CAS number 88562-10-1, is an organic compound characterized by its bicyclic structure featuring a cyclohexane ring with two ketone functional groups at the 1 and 3 positions. The presence of the 2-(2-iodobenzoyl) substituent introduces an aromatic component, enhancing its reactivity and potential applications in organic synthesis. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its chemical properties are influenced by the electron-withdrawing nature of the iodobenzoyl group, which can affect its reactivity in nucleophilic substitution and other reactions. Additionally, the compound may display interesting optical properties due to the presence of the aromatic ring. Safety data should be consulted, as the iodobenzoyl moiety may pose specific hazards. Overall, 1,3-Cyclohexanedione, 2-(2-iodobenzoyl)- is of interest in various fields, including medicinal chemistry and materials science, due to its unique structural features and potential reactivity.
Formula:C13H11IO3
InChI:InChI=1S/C13H11IO3/c14-9-5-2-1-4-8(9)13(17)12-10(15)6-3-7-11(12)16/h1-2,4-5,12H,3,6-7H2
InChI key:OGHGLYVCKWVCJJ-UHFFFAOYSA-N
SMILES:C1CC(=O)C(C(=O)C1)C(=O)C2=CC=CC=C2I
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
