CymitQuimica logo

CAS 88562-14-5

:

1,3-Cyclohexanedione, 2-(2,3,5-triiodobenzoyl)-

Description:
1,3-Cyclohexanedione, 2-(2,3,5-triiodobenzoyl)-, with the CAS number 88562-14-5, is a chemical compound characterized by its unique structure that includes a cyclohexanedione core and a triiodobenzoyl substituent. This compound typically exhibits properties associated with diketones, such as the ability to participate in various chemical reactions, including condensation and oxidation. The presence of the triiodobenzoyl group introduces significant iodine content, which can influence the compound's reactivity and solubility in different solvents. Additionally, the iodine atoms may impart unique optical properties, making it of interest in applications such as imaging or as a reagent in organic synthesis. The compound's stability, melting point, and boiling point can vary based on environmental conditions and purity. Overall, 1,3-Cyclohexanedione, 2-(2,3,5-triiodobenzoyl)- is a specialized compound with potential applications in pharmaceuticals, materials science, and chemical research.
Formula:C13H9I3O3
InChI:InChI=1S/C13H9I3O3/c14-6-4-7(12(16)8(15)5-6)13(19)11-9(17)2-1-3-10(11)18/h4-5,11H,1-3H2
InChI key:SIXNEERFYGDIPE-UHFFFAOYSA-N
SMILES:C1CC(=O)C(C(=O)C1)C(=O)C2=C(C(=CC(=C2)I)I)I
Found 1 products.