CymitQuimica logo

CAS 88562-21-4

:

1,3-Cyclohexanedione, 2-(2-chloro-5-nitrobenzoyl)-

Description:
1,3-Cyclohexanedione, 2-(2-chloro-5-nitrobenzoyl)-, with the CAS number 88562-21-4, is an organic compound characterized by its bicyclic structure featuring a cyclohexanedione moiety and a substituted benzoyl group. This compound typically exhibits a pale yellow to brownish appearance and is soluble in organic solvents, reflecting its non-polar characteristics. The presence of the chloro and nitro substituents on the benzoyl group contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The nitro group, in particular, can enhance the compound's electrophilic properties, making it useful in various chemical reactions. Additionally, the compound may exhibit biological activity, which warrants further investigation for potential pharmaceutical applications. Safety data should be consulted, as the presence of chlorine and nitro groups may pose hazards. Overall, 1,3-Cyclohexanedione, 2-(2-chloro-5-nitrobenzoyl)- is a versatile compound with significant implications in chemical research and development.
Formula:C13H10ClNO5
InChI:InChI=1S/C13H10ClNO5/c14-9-5-4-7(15(19)20)6-8(9)13(18)12-10(16)2-1-3-11(12)17/h4-6,12H,1-3H2
InChI key:XKXDOZVYQFDBPF-UHFFFAOYSA-N
SMILES:C1CC(=O)C(C(=O)C1)C(=O)C2=C(C=CC(=C2)[N+](=O)[O-])Cl
Found 1 products.