CAS 88563-51-3
:Benzoic acid, pentafluoro-, 1-(4-methylphenyl)ethyl ester
Description:
Benzoic acid, pentafluoro-, 1-(4-methylphenyl)ethyl ester, with the CAS number 88563-51-3, is an organic compound characterized by its ester functional group and the presence of both pentafluorobenzene and a 4-methylphenyl moiety. This compound features a benzoic acid backbone where the hydrogen atom of the carboxylic acid group is replaced by a 1-(4-methylphenyl)ethyl group, resulting in an ester. The presence of five fluorine atoms on the benzene ring significantly influences its chemical properties, including increased lipophilicity and altered reactivity compared to non-fluorinated analogs. This compound is likely to exhibit low volatility and high thermal stability due to the strong C-F bonds. Additionally, the fluorinated structure may impart unique biological activity and environmental persistence. Its applications may span various fields, including pharmaceuticals, agrochemicals, and materials science, where its specific properties can be utilized for targeted functions. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and environmental impact.
Formula:C16H11F5O2
InChI:InChI=1S/C16H11F5O2/c1-7-3-5-9(6-4-7)8(2)23-16(22)10-11(17)13(19)15(21)14(20)12(10)18/h3-6,8H,1-2H3
InChI key:WWZARCTVHRUYIP-UHFFFAOYSA-N
SMILES:CC1=CC=C(C=C1)C(C)OC(=O)C2=C(C(=C(C(=C2F)F)F)F)F
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Benzoic acid, pentafluoro-, 1-(4-methylphenyl)ethyl ester
CAS:Formula:C16H11F5O2Molecular weight:330.2494
