CymitQuimica logo

CAS 88563-54-6

:

Benzene, 4-(1-chloroethyl)-1-methoxy-2-nitro-

Description:
Benzene, 4-(1-chloroethyl)-1-methoxy-2-nitro- is an organic compound characterized by its aromatic benzene ring substituted with various functional groups. The presence of a chloroethyl group indicates that it has a chlorine atom attached to a carbon chain, which can influence its reactivity and solubility. The methoxy group (-OCH3) contributes to its overall polarity and can affect its interaction with other substances. Additionally, the nitro group (-NO2) is known for its electron-withdrawing properties, which can enhance the compound's reactivity in electrophilic substitution reactions. This compound may exhibit moderate to high toxicity, and its handling requires appropriate safety precautions due to the presence of chlorine and nitro groups, which are associated with potential environmental and health hazards. Its applications may vary, including use in organic synthesis or as an intermediate in the production of other chemical compounds. As with many aromatic compounds, it is important to consider its behavior in various chemical environments, including its stability and reactivity under different conditions.
Formula:C9H10ClNO3
InChI:InChI=1S/C9H10ClNO3/c1-6(10)7-3-4-9(14-2)8(5-7)11(12)13/h3-6H,1-2H3
InChI key:QNXVBTKVPNDGIW-UHFFFAOYSA-N
SMILES:CC(C1=CC(=C(C=C1)OC)[N+](=O)[O-])Cl
Found 1 products.