CymitQuimica logo

CAS 88563-59-1

:

2,4-Cyclohexadien-1-one, 2,3-diethyl-4-methoxy-6,6-dimethyl-

Description:
2,4-Cyclohexadien-1-one, 2,3-diethyl-4-methoxy-6,6-dimethyl- is an organic compound characterized by its unique bicyclic structure, which features a cyclohexadiene ring system with various substituents. The presence of the ketone functional group (indicated by the "1-one" in its name) suggests that it exhibits reactivity typical of carbonyl compounds, such as nucleophilic addition. The diethyl and dimethyl groups contribute to its hydrophobic character, while the methoxy group enhances its solubility in organic solvents. This compound may exhibit interesting optical and electronic properties due to its conjugated system, making it potentially useful in organic synthesis and materials science. Additionally, its structural features may influence its biological activity, although specific biological properties would require further investigation. Overall, this compound exemplifies the complexity and diversity of organic molecules, with implications for both synthetic chemistry and potential applications in various fields.
Formula:C13H20O2
InChI:InChI=1S/C13H20O2/c1-6-9-10(7-2)12(14)13(3,4)8-11(9)15-5/h8H,6-7H2,1-5H3
InChI key:OVULHDVNMCBSDY-UHFFFAOYSA-N
SMILES:CCC1=C(C(=O)C(C=C1OC)(C)C)CC
Found 1 products.