CymitQuimica logo

CAS 88563-83-1

:

1-(1-Bromoethyl)-3-methoxybenzene

Description:
1-(1-Bromoethyl)-3-methoxybenzene, also known as 3-methoxy-1-(1-bromoethyl)benzene, is an organic compound characterized by its aromatic structure and the presence of both a bromine atom and a methoxy group. The compound features a bromine atom attached to a carbon that is also bonded to an ethyl group, which contributes to its reactivity and potential applications in organic synthesis. The methoxy group (-OCH3) is located at the meta position relative to the bromoethyl group on the benzene ring, influencing the compound's electronic properties and steric effects. This compound is typically a colorless to pale yellow liquid with a distinctive odor, and it is soluble in organic solvents. Its reactivity allows it to participate in various chemical reactions, making it useful in the synthesis of more complex organic molecules. Safety precautions should be taken when handling this compound, as it may pose health risks due to the presence of bromine, which is a halogen known for its potential toxicity and environmental impact.
Formula:C9H11BrO
InChI:InChI=1S/C9H11BrO/c1-7(10)8-4-3-5-9(6-8)11-2/h3-7H,1-2H3
InChI key:InChIKey=YGBWEVLCLQXBKI-UHFFFAOYSA-N
SMILES:C(Br)(C)C1=CC(OC)=CC=C1
Synonyms:
  • 1-(1-Bromoethyl)-3-methoxybenzene
  • Benzene, 1-(1-bromoethyl)-3-methoxy-
Found 4 products.