CymitQuimica logo

CAS 88565-88-2

:

4,6,8-trimethylquinoline

Description:
4,6,8-Trimethylquinoline is an organic compound belonging to the quinoline family, characterized by a bicyclic structure that includes a benzene ring fused to a pyridine ring. This compound features three methyl groups attached to the quinoline structure at the 4, 6, and 8 positions, which influences its chemical properties and reactivity. It is typically a yellow to brown liquid or solid, depending on its purity and temperature. The presence of the methyl groups enhances its lipophilicity, making it soluble in organic solvents while being less soluble in water. 4,6,8-Trimethylquinoline exhibits fluorescence and can be used in various applications, including as a dye or in the synthesis of other chemical compounds. Its chemical behavior is influenced by the electron-donating nature of the methyl groups, which can affect its reactivity in electrophilic aromatic substitution reactions. Additionally, it may have potential applications in the fields of pharmaceuticals and materials science, although specific uses may vary based on ongoing research and development.
Formula:C12H13N
InChI:InChI=1/C12H13N/c1-8-6-10(3)12-11(7-8)9(2)4-5-13-12/h4-7H,1-3H3
InChI key:HNCYZWOTJQPKTQ-UHFFFAOYSA-N
SMILES:Cc1cc(C)c2c(c1)c(C)ccn2
Synonyms:
  • Quinoline, 4,6,8-Trimethyl-
  • 4,6,8-Trimethylquinoline
Found 4 products.