CymitQuimica logo

CAS 885669-12-5

:

N'-tert-butyl-N'-phenyl-acetohydrazide

Description:
N'-tert-butyl-N'-phenyl-acetohydrazide is an organic compound characterized by its hydrazide functional group, which consists of a hydrazine moiety attached to an acyl group. This compound features a tert-butyl group and a phenyl group, contributing to its hydrophobic characteristics and potential for various chemical interactions. It typically appears as a solid at room temperature and may exhibit moderate solubility in organic solvents due to its non-polar tert-butyl and phenyl substituents. The presence of the hydrazide functional group suggests potential reactivity in condensation reactions, making it useful in synthetic organic chemistry. Additionally, compounds of this nature may exhibit biological activity, which could be of interest in pharmaceutical applications. However, specific properties such as melting point, boiling point, and spectral data would need to be referenced from experimental sources or databases for precise information. Safety data should also be consulted, as hydrazine derivatives can be hazardous.
Formula:C12H18N2O
InChI:InChI=1/C12H18N2O/c1-10(15)13-14(12(2,3)4)11-8-6-5-7-9-11/h5-9H,1-4H3,(H,13,15)
InChI key:HDUCLRWIXMYNKV-UHFFFAOYSA-N
SMILES:CC(=O)NN(C1=CC=CC=C1)C(C)(C)C
Found 2 products.