CAS 885676-07-3
:2H-Isoxazolo[3,4,5-de]isoquinoline(9CI)
Description:
2H-Isoxazolo[3,4,5-de]isoquinoline, identified by its CAS number 885676-07-3, is a heterocyclic compound featuring a fused isoxazole and isoquinoline structure. This compound typically exhibits a range of interesting chemical properties due to the presence of both nitrogen and oxygen atoms in its ring systems, which can influence its reactivity and interactions with other molecules. It may display biological activity, making it of interest in medicinal chemistry and drug development. The isoxazole moiety can contribute to its potential as a pharmacophore, while the isoquinoline framework may enhance its ability to interact with biological targets. Additionally, this compound may possess unique optical properties, which can be useful in various applications, including fluorescence and photochemistry. Its synthesis often involves multi-step organic reactions, and it may be characterized using techniques such as NMR spectroscopy, mass spectrometry, and X-ray crystallography to confirm its structure and purity. Overall, 2H-Isoxazolo[3,4,5-de]isoquinoline represents a fascinating area of study within the field of organic and medicinal chemistry.
Formula:C9H6N2O
InChI:InChI=1S/C9H6N2O/c1-2-6-4-10-5-7-9(6)8(3-1)12-11-7/h1-5,11H
InChI key:YUGYLCJDIVWVME-UHFFFAOYSA-N
SMILES:C1=CC2=CN=CC3=C2C(=C1)ON3
Synonyms:- 2H-Isoxazolo[3,4,5-de]isoquinoline (9CI)
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
