CymitQuimica logo

CAS 885687-65-0

:

Quinoline, 2-methoxy-8-methyl-

Description:
Quinoline, 2-methoxy-8-methyl- is an organic compound belonging to the quinoline family, characterized by a bicyclic structure consisting of a benzene ring fused to a pyridine ring. This compound features a methoxy group (-OCH3) at the 2-position and a methyl group (-CH3) at the 8-position of the quinoline structure, which influences its chemical properties and reactivity. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Quinoline derivatives are known for their diverse biological activities, including antimicrobial and antitumor properties, making them of interest in medicinal chemistry. The presence of the methoxy and methyl substituents can enhance the compound's lipophilicity, potentially affecting its pharmacokinetics and interaction with biological targets. Additionally, quinoline derivatives can participate in various chemical reactions, including electrophilic substitutions and complexation with metal ions, which may be relevant in coordination chemistry and catalysis. Overall, quinoline, 2-methoxy-8-methyl- represents a significant compound for further research in both synthetic and medicinal chemistry.
Formula:C11H11NO
InChI:InChI=1S/C11H11NO/c1-8-4-3-5-9-6-7-10(13-2)12-11(8)9/h3-7H,1-2H3
InChI key:YBPVXEYERZMYNR-UHFFFAOYSA-N
SMILES:CC1=C2C(=CC=C1)C=CC(=N2)OC
Found 2 products.