CAS 88569-90-8
:1,3-Cyclohexanedione, 2-(2,5-dichlorobenzoyl)-5,5-dimethyl-
Description:
1,3-Cyclohexanedione, 2-(2,5-dichlorobenzoyl)-5,5-dimethyl- is an organic compound characterized by its bicyclic structure, which includes a cyclohexane ring with two ketone functional groups at the 1 and 3 positions. The presence of a 2,5-dichlorobenzoyl group introduces significant steric and electronic effects, influencing its reactivity and solubility. This compound is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its dichlorobenzoyl moiety can enhance its potential for applications in organic synthesis and as an intermediate in the production of various chemical products. The dimethyl substituents at the 5-position contribute to its steric bulk, which can affect its interactions with other molecules. Additionally, the compound may exhibit specific optical properties due to its structural features, making it of interest in fields such as materials science and pharmaceuticals. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.
Formula:C15H14Cl2O3
InChI:InChI=1S/C15H14Cl2O3/c1-15(2)6-11(18)13(12(19)7-15)14(20)9-5-8(16)3-4-10(9)17/h3-5,13H,6-7H2,1-2H3
InChI key:ZNAYJFZWPASSHR-UHFFFAOYSA-N
SMILES:CC1(CC(=O)C(C(=O)C1)C(=O)C2=C(C=CC(=C2)Cl)Cl)C
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1,3-Cyclohexanedione, 2-(2,5-dichlorobenzoyl)-5,5-dimethyl-
CAS:Formula:C15H14Cl2O3Molecular weight:313.1759
