CymitQuimica logo

CAS 885693-20-9

:

1-Boc-3,6-dihydro-2H-pyridine-5-boronic acid pinacol ester

Description:
1-Boc-3,6-dihydro-2H-pyridine-5-boronic acid pinacol ester is a chemical compound characterized by its unique structural features, which include a boronic acid moiety and a Boc (tert-butyloxycarbonyl) protecting group. This compound typically exhibits a pyridine ring that is partially saturated, contributing to its reactivity and potential applications in organic synthesis, particularly in the formation of carbon-carbon bonds through Suzuki coupling reactions. The presence of the pinacol ester enhances its stability and solubility in organic solvents, making it suitable for various synthetic pathways. Additionally, the Boc group serves as a protective group for amines, allowing for selective reactions without interference from the amine functionality. This compound is often utilized in medicinal chemistry and materials science due to its ability to participate in diverse chemical transformations. Its boronic acid functionality is particularly valuable in the development of pharmaceuticals and agrochemicals, where it can facilitate the introduction of boron into complex molecular architectures.
Formula:C16H28BNO4
InChI:InChI=1/C16H28BNO4/c1-14(2,3)20-13(19)18-10-8-9-12(11-18)17-21-15(4,5)16(6,7)22-17/h9H,8,10-11H2,1-7H3
InChI key:KEEIJBAOTMNSEN-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC=C(C1)B1OC(C)(C)C(C)(C)O1
Synonyms:
  • Tert-Butyl 5-(Tetramethyl-1,3,2-Dioxaborolan-2-Yl)-1,2,3,6-Tetrahydropyridine-1-Carboxylate
  • 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylic acid tert-butyl ester
  • Tert-Butyl 5-(4,4,5,5-Tetramethyl-1,3,2-Dioxaborolan-2-Yl)-3,6-Dihydropyridine-1(2H)-Carboxylate
  • 1-Boc-3,6-dihydropyridine-5-boronic acid pinacol ester
Found 7 products.