CymitQuimica logo

CAS 885693-48-1

:

tert-Butyl 3-amino-6-(piperidin-4-yl)pyridine-1(2H)-carboxylate

Description:
Tert-Butyl 3-amino-6-(piperidin-4-yl)pyridine-1(2H)-carboxylate is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with an amino group and a piperidine moiety. This compound features a tert-butyl ester functional group, which contributes to its lipophilicity and potential solubility in organic solvents. The presence of the amino group suggests potential for hydrogen bonding and reactivity, making it a candidate for various chemical reactions, including those in medicinal chemistry. The piperidine ring adds to its structural diversity and may influence its biological activity. This compound is likely to be of interest in pharmaceutical research, particularly in the development of new therapeutic agents, due to its potential interactions with biological targets. Its CAS number, 885693-48-1, allows for easy identification and reference in chemical databases. Overall, the characteristics of this compound suggest it may have applications in drug discovery and development, particularly in areas requiring compounds with specific pharmacological properties.
Formula:C15H25N3O2
InChI:InChI=1/C15H25N3O2/c1-15(2,3)20-14(19)18-10-12(16)4-5-13(18)11-6-8-17-9-7-11/h4-5,11,17H,6-10,16H2,1-3H3
InChI key:XVFBFTRNOMROEW-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CC(=CC=C1C1CCNCC1)N
Found 4 products.