CymitQuimica logo

CAS 885694-00-8

:

7-(Trifluoromethyl)-1H-indazole

Description:
7-(Trifluoromethyl)-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure consisting of a five-membered pyrazole ring fused to a six-membered benzene ring. The presence of a trifluoromethyl group (-CF3) at the 7-position significantly influences its chemical properties, enhancing its lipophilicity and potentially its biological activity. This compound is typically used in medicinal chemistry and research due to its potential as a pharmacophore in drug development. It may exhibit various biological activities, including anti-inflammatory and anticancer properties, owing to the electron-withdrawing nature of the trifluoromethyl group, which can affect the compound's reactivity and interaction with biological targets. Additionally, 7-(Trifluoromethyl)-1H-indazole is often studied for its role in the synthesis of more complex molecules and its utility in various chemical reactions. As with many fluorinated compounds, it may also exhibit unique stability and solubility characteristics, making it of interest in both academic and industrial applications.
Formula:C8H5F3N2
InChI:InChI=1S/C8H5F3N2/c9-8(10,11)6-3-1-2-5-4-12-13-7(5)6/h1-4H,(H,12,13)
InChI key:InChIKey=NCLVEPKBXAQQDN-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C2C(=CC=C1)C=NN2
Synonyms:
  • 7-(Trifluoromethyl)-1H-indazole
  • 1H-Indazole, 7-(trifluoromethyl)-
Found 4 products.