CAS 88570-23-4
:2,4-Pentanedione, 3-[2,2-dichloro-1-(1H-1,2,4-triazol-1-yl)ethenyl]-
Description:
2,4-Pentanedione, 3-[2,2-dichloro-1-(1H-1,2,4-triazol-1-yl)ethenyl]- is a chemical compound characterized by its complex structure, which includes a diketone moiety and a triazole ring. This compound is typically used in agricultural applications, particularly as a fungicide due to its ability to inhibit fungal growth. It exhibits moderate to high solubility in organic solvents, which facilitates its application in various formulations. The presence of the dichloro and triazole groups contributes to its biological activity and stability. Additionally, the compound may possess specific reactivity patterns typical of diketones, such as undergoing condensation reactions. Safety data sheets indicate that it should be handled with care, as it may pose health risks if inhaled or ingested. Overall, 2,4-Pentanedione, 3-[2,2-dichloro-1-(1H-1,2,4-triazol-1-yl)ethenyl]- is a significant compound in the field of agrochemicals, with properties that warrant further investigation for its efficacy and environmental impact.
Formula:C9H9Cl2N3O2
InChI:InChI=1S/C9H9Cl2N3O2/c1-5(15)7(6(2)16)8(9(10)11)14-4-12-3-13-14/h3-4,7H,1-2H3
InChI key:CLDMDRWUZYYUSV-UHFFFAOYSA-N
SMILES:CC(=O)C(C(=O)C)C(=C(Cl)Cl)N1C=NC=N1
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2,4-Pentanedione, 3-[2,2-dichloro-1-(1H-1,2,4-triazol-1-yl)ethenyl]-
CAS:Formula:C9H9Cl2N3O2Molecular weight:262.0927
