CymitQuimica logo

CAS 88570-77-8

:

Ethenol, 2-phenyl-2-(1-piperidinyl)-

Description:
Ethenol, 2-phenyl-2-(1-piperidinyl)-, also known by its CAS number 88570-77-8, is a chemical compound characterized by its unique structure that includes a phenyl group and a piperidine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and interactions. It is likely to be a colorless to pale yellow liquid or solid, depending on its specific formulation and purity. The presence of the piperidine ring suggests that it may exhibit basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Additionally, the phenyl group can influence its solubility and stability in different solvents. Ethenol derivatives often find applications in pharmaceuticals, agrochemicals, and materials science due to their ability to act as intermediates or functional agents in synthesis. However, specific safety and handling guidelines should be followed, as with any chemical substance, to mitigate potential hazards associated with its use.
Formula:C13H17NO
InChI:InChI=1S/C13H17NO/c15-11-13(12-7-3-1-4-8-12)14-9-5-2-6-10-14/h1,3-4,7-8,11,15H,2,5-6,9-10H2
InChI key:MJVQGPWVTKKLOB-UHFFFAOYSA-N
SMILES:C1CCN(CC1)C(=CO)C2=CC=CC=C2
Found 1 products.