CymitQuimica logo

CAS 88571-27-1

:

Carbonic acid, 3-bromopropyl hexyl ester

Description:
Carbonic acid, 3-bromopropyl hexyl ester, with the CAS number 88571-27-1, is an organic compound that belongs to the class of carbonic acid esters. This substance features a carbonic acid moiety where the hydroxyl group is replaced by a 3-bromopropyl group and a hexyl group, contributing to its ester characteristics. It is typically a colorless to pale yellow liquid with a distinctive odor, indicative of its organic nature. The presence of the bromine atom in the 3-bromopropyl group can impart unique reactivity, making it useful in various chemical syntheses and applications. The compound is likely to be soluble in organic solvents, while its solubility in water may be limited due to the hydrophobic hexyl chain. As with many esters, it may exhibit moderate volatility and can participate in hydrolysis reactions under certain conditions. Safety data should be consulted for handling, as halogenated compounds can pose health and environmental risks. Overall, its unique structure and properties make it of interest in both industrial and research contexts.
Formula:C10H19BrO3
InChI:InChI=1S/C10H19BrO3/c1-2-3-4-5-8-13-10(12)14-9-6-7-11/h2-9H2,1H3
InChI key:JKVRHMJMIJYRHK-UHFFFAOYSA-N
SMILES:CCCCCCOC(=O)OCCCBr
Found 1 products.