CAS 88571-43-1
:2H-Pyrrol-2-one, 1,3-dihydro-3,5-dimethyl-
Description:
2H-Pyrrol-2-one, 1,3-dihydro-3,5-dimethyl- is an organic compound characterized by its pyrrolone structure, which features a five-membered ring containing both nitrogen and a carbonyl group. This compound is a derivative of pyrrolidinone, specifically modified with two methyl groups at the 3 and 5 positions of the ring. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. The presence of the carbonyl group contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions and cycloadditions. It may exhibit moderate solubility in polar solvents due to its polar functional groups. Additionally, this compound may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C6H9NO
InChI:InChI=1S/C6H9NO/c1-4-3-5(2)7-6(4)8/h3-4H,1-2H3,(H,7,8)
InChI key:ONMLRXAMASYDNW-UHFFFAOYSA-N
SMILES:CC1C=C(NC1=O)C
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
