CymitQuimica logo

CAS 88571-75-9

:

1,4-dihydroxy-3,3,6,6-tetramethylpiperazine-2,5-dione

Description:
1,4-Dihydroxy-3,3,6,6-tetramethylpiperazine-2,5-dione, also known as a derivative of piperazine, is a chemical compound characterized by its unique structure that includes two hydroxyl groups and a diketone functionality. This compound typically appears as a solid at room temperature and is soluble in polar solvents due to the presence of hydroxyl groups, which enhance its ability to engage in hydrogen bonding. The presence of the tetramethyl substituents contributes to its steric bulk, potentially influencing its reactivity and interactions with other molecules. It may exhibit biological activity, making it of interest in pharmaceutical and biochemical research. The compound's CAS number, 88571-75-9, allows for its identification in chemical databases and literature. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, 1,4-dihydroxy-3,3,6,6-tetramethylpiperazine-2,5-dione represents a versatile structure with potential applications in various fields of chemistry and materials science.
Formula:C8H14N2O4
InChI:InChI=1/C8H14N2O4/c1-7(2)5(11)10(14)8(3,4)6(12)9(7)13/h13-14H,1-4H3
SMILES:CC1(C)C(=O)N(C(C)(C)C(=O)N1O)O
Synonyms:
  • 2,5-Piperazinedione, 1,4-dihydroxy-3,3,6,6-tetramethyl-
  • 1,4-Dihydroxy-3,3,6,6-tetramethylpiperazine-2,5-dione
Found 1 products.