CymitQuimica logo

CAS 88572-06-9

:

2-Thiazolamine, 4-[tetrahydro-2-(1-methylethyl)-2H-pyran-4-yl]-

Description:
2-Thiazolamine, 4-[tetrahydro-2-(1-methylethyl)-2H-pyran-4-yl]- is a chemical compound characterized by its unique structural features, which include a thiazole ring and a tetrahydropyran moiety. The thiazole ring contributes to its potential biological activity, often associated with compounds that exhibit antimicrobial or antifungal properties. The presence of the tetrahydropyran structure, particularly with the isopropyl group, may influence the compound's solubility and lipophilicity, affecting its pharmacokinetic properties. This compound is typically synthesized through organic reactions involving thiazole derivatives and pyran-based intermediates. Its applications may extend to medicinal chemistry, where it could serve as a lead compound for drug development. However, specific biological activities, toxicity, and environmental impact would require further investigation through experimental studies. As with many organic compounds, proper handling and safety measures should be observed due to potential hazards associated with chemical exposure.
Formula:C11H18N2OS
InChI:InChI=1S/C11H18N2OS/c1-7(2)10-5-8(3-4-14-10)9-6-15-11(12)13-9/h6-8,10H,3-5H2,1-2H3,(H2,12,13)
InChI key:JXYPLQDIDJLTJJ-UHFFFAOYSA-N
SMILES:CC(C)C1CC(CCO1)C2=CSC(=N2)N
Found 1 products.