CAS 88572-33-2
:Thiazole, 4-phenyl-2-(tetrahydro-2-methyl-2H-pyran-4-yl)-, hydrochloride
Description:
Thiazole, 4-phenyl-2-(tetrahydro-2-methyl-2H-pyran-4-yl)-, hydrochloride, with the CAS number 88572-33-2, is a chemical compound characterized by its thiazole ring structure, which is a five-membered heterocyclic compound containing both sulfur and nitrogen atoms. This compound features a phenyl group and a tetrahydro-2-methyl-2H-pyran moiety, contributing to its unique properties and potential biological activities. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, which often enhances its solubility in water and stability. Thiazoles are known for their diverse applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The specific substitution patterns in this compound may influence its reactivity and interactions with biological targets, making it of interest in medicinal chemistry. Overall, the compound's structure suggests potential for various applications, particularly in drug development, although detailed studies would be necessary to elucidate its specific properties and biological activities.
Formula:C15H17NOSClH
InChI:InChI=1S/C15H17NOS.ClH/c1-11-9-13(7-8-17-11)15-16-14(10-18-15)12-5-3-2-4-6-12;/h2-6,10-11,13H,7-9H2,1H3;1H
InChI key:IFQJHKGHMYJCSG-UHFFFAOYSA-N
SMILES:CC1CC(CCO1)C2=NC(=CS2)C3=CC=CC=C3.Cl
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Thiazole, 4-phenyl-2-(tetrahydro-2-methyl-2H-pyran-4-yl)-, hydrochloride
CAS:Formula:C15H18ClNOSMolecular weight:295.8275
