CymitQuimica logo

CAS 88576-35-6

:

Benzene, 1-(2-butenylsulfonyl)-4-chloro-

Description:
Benzene, 1-(2-butenylsulfonyl)-4-chloro- is an organic compound characterized by its benzene ring substituted with a butenylsulfonyl group and a chlorine atom at the para position. This compound features a sulfonyl group, which typically enhances its reactivity and solubility in polar solvents. The presence of the chlorine atom introduces additional reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The butenyl group contributes to the compound's overall hydrophobic character while also providing sites for further functionalization. As a sulfonyl derivative, it may exhibit properties such as increased stability and resistance to hydrolysis compared to other functional groups. The compound's structure suggests potential applications in organic synthesis, pharmaceuticals, or agrochemicals, where the unique combination of its functional groups can be exploited. However, specific safety and handling guidelines should be followed due to the presence of chlorine and the potential for reactivity associated with the sulfonyl group.
Formula:C10H11ClO2S
InChI:InChI=1S/C10H11ClO2S/c1-2-3-8-14(12,13)10-6-4-9(11)5-7-10/h2-7H,8H2,1H3
InChI key:FAIKRMHJXJBYJI-UHFFFAOYSA-N
SMILES:CC=CCS(=O)(=O)C1=CC=C(C=C1)Cl
Found 1 products.