CymitQuimica logo

CAS 88576-37-8

:

Benzene, 1-bromo-4-[(1-methyl-2-propenyl)sulfonyl]-

Description:
Benzene, 1-bromo-4-[(1-methyl-2-propenyl)sulfonyl]- is an organic compound characterized by its aromatic benzene ring substituted with a bromine atom and a sulfonyl group attached to a propenyl chain. The presence of the bromine atom indicates that it is a halogenated compound, which can enhance its reactivity, particularly in nucleophilic substitution reactions. The sulfonyl group contributes to the compound's polarity and can influence its solubility in various solvents. This compound may exhibit unique chemical properties due to the combination of the aromatic system and the functional groups present, making it potentially useful in organic synthesis and as an intermediate in the production of other chemical entities. Additionally, the structure suggests that it may participate in electrophilic aromatic substitution reactions, and the propenyl group could allow for further functionalization. Safety and handling precautions should be observed, as halogenated compounds can pose health risks and environmental concerns.
Formula:C10H11BrO2S
InChI:InChI=1S/C10H11BrO2S/c1-3-8(2)14(12,13)10-6-4-9(11)5-7-10/h3-8H,1H2,2H3
InChI key:SCMPCODGOVUVAM-UHFFFAOYSA-N
SMILES:CC(C=C)S(=O)(=O)C1=CC=C(C=C1)Br
Found 1 products.