CymitQuimica logo

CAS 88576-67-4

:

Benzamide, 5-bromo-2-(ethenyloxy)-

Description:
Benzamide, 5-bromo-2-(ethenyloxy)-, identified by its CAS number 88576-67-4, is an organic compound that features a benzamide structure with a bromine substituent and an ethenyloxy group. This compound typically exhibits characteristics common to aromatic amides, including a relatively high melting point and solubility in polar solvents due to the presence of the amide functional group. The bromine atom introduces additional reactivity, making it a potential candidate for various chemical reactions, such as nucleophilic substitutions or coupling reactions. The ethenyloxy group contributes to its reactivity, allowing for potential applications in organic synthesis and materials science. The presence of both the bromine and the ethenyloxy moiety can influence the compound's electronic properties, potentially affecting its behavior in biological systems or as a reagent in synthetic pathways. Overall, benzamide derivatives like this one are of interest in medicinal chemistry and materials development due to their diverse functional properties.
Formula:C9H8BrNO2
InChI:InChI=1S/C9H8BrNO2/c1-2-13-8-4-3-6(10)5-7(8)9(11)12/h2-5H,1H2,(H2,11,12)
InChI key:XFDIILHJMSPVHF-UHFFFAOYSA-N
SMILES:C=COC1=C(C=C(C=C1)Br)C(=O)N
Found 1 products.