CymitQuimica logo

CAS 88576-71-0

:

Benzenesulfonamide, N-(10-chloro-9-phenanthrenyl)-

Description:
Benzenesulfonamide, N-(10-chloro-9-phenanthrenyl)-, identified by the CAS number 88576-71-0, is a chemical compound that features a sulfonamide functional group attached to a phenanthrene moiety with a chlorine substituent. This compound typically exhibits characteristics common to sulfonamides, such as potential antibacterial properties, due to the presence of the sulfonamide group, which can interfere with bacterial folic acid synthesis. The phenanthrene structure contributes to its aromaticity and stability, while the chlorine atom may influence its reactivity and solubility in various solvents. The compound's molecular structure suggests it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, its unique combination of functional groups may impart specific biological activities, making it a subject of interest in research related to drug design and development. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample.
Formula:C20H14ClNO2S
InChI:InChI=1S/C20H14ClNO2S/c21-19-17-12-6-4-10-15(17)16-11-5-7-13-18(16)20(19)22-25(23,24)14-8-2-1-3-9-14/h1-13,22H
InChI key:XEHMONZMZVISRN-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)S(=O)(=O)NC2=C(C3=CC=CC=C3C4=CC=CC=C42)Cl
Found 1 products.