CymitQuimica logo

CAS 88578-23-8

:

Diazene, (3-chloro-4-methoxyphenyl)(2,5-dimethylphenyl)-

Description:
Diazene, (3-chloro-4-methoxyphenyl)(2,5-dimethylphenyl)-, with the CAS number 88578-23-8, is an organic compound characterized by its diazene functional group, which features a nitrogen-nitrogen double bond. This compound exhibits a complex structure due to the presence of a chloro substituent and a methoxy group on one aromatic ring, along with two methyl groups on another aromatic ring. The presence of these substituents influences its chemical reactivity and physical properties, such as solubility and boiling point. Diazene derivatives are often studied for their potential applications in organic synthesis and materials science, particularly in the development of azo compounds and as intermediates in various chemical reactions. The compound's stability can be affected by the electronic effects of the substituents, and it may undergo reactions typical of diazenes, such as thermal decomposition or coupling reactions. Overall, this compound represents a unique combination of functional groups that can lead to diverse chemical behavior.
Formula:C15H15ClN2O
InChI:InChI=1S/C15H15ClN2O/c1-10-4-5-11(2)14(8-10)18-17-12-6-7-15(19-3)13(16)9-12/h4-9H,1-3H3
InChI key:LWVHDDNSSZYWIV-UHFFFAOYSA-N
SMILES:CC1=CC(=C(C=C1)C)N=NC2=CC(=C(C=C2)OC)Cl
Found 1 products.