CymitQuimica logo

CAS 88578-90-9

:

2-chloro-4-fluorobenzamide

Description:
2-Chloro-4-fluorobenzamide is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both a chlorine atom and a fluorine atom, as well as an amide functional group. The presence of the chlorine and fluorine substituents contributes to its unique chemical properties, including increased polarity and potential reactivity. This compound typically appears as a solid at room temperature and is soluble in organic solvents. Its molecular structure allows for various applications in pharmaceuticals and agrochemicals, often serving as an intermediate in the synthesis of more complex molecules. The compound's reactivity can be influenced by the electron-withdrawing effects of the halogen substituents, which can affect its behavior in chemical reactions, such as nucleophilic substitutions or coupling reactions. Safety data sheets should be consulted for handling and toxicity information, as halogenated compounds can pose environmental and health risks. Overall, 2-chloro-4-fluorobenzamide is a significant compound in organic chemistry with diverse applications.
Formula:C7H5ClFNO
InChI:InChI=1/C7H5ClFNO/c8-6-3-4(9)1-2-5(6)7(10)11/h1-3H,(H2,10,11)
InChI key:XIQZTMMWBKPFSE-UHFFFAOYSA-N
SMILES:c1cc(c(cc1F)Cl)C(=N)O
Synonyms:
  • Zvr Bg Df
Found 4 products.