CAS 88579-80-0
:Ethanehydrazonoyl fluoride, 2,2,2-trifluoro-N-(tetrafluoroethylidene)-
Description:
Ethanehydrazonoyl fluoride, specifically 2,2,2-trifluoro-N-(tetrafluoroethylidene)-, is a chemical compound characterized by its unique structure that includes a hydrazone functional group and multiple fluorinated substituents. The presence of trifluoro and tetrafluoro groups contributes to its high stability and low reactivity under standard conditions, making it useful in various applications, particularly in the field of fluorinated compounds. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific form and purity. Its fluorinated nature imparts significant hydrophobicity and lipophobicity, which can influence its behavior in biological systems and its solubility in organic solvents. Ethanehydrazonoyl fluoride is often utilized in synthetic organic chemistry, particularly in the development of fluorinated pharmaceuticals and agrochemicals. Safety precautions are essential when handling this compound due to its potential toxicity and reactivity with moisture, which can lead to the release of hazardous gases. Proper storage and handling protocols should be followed to mitigate risks associated with exposure.
Formula:C4F8N2
InChI:InChI=1S/C4F8N2/c5-1(3(7,8)9)13-14-2(6)4(10,11)12
InChI key:SDMXZLUEXSYRIX-UHFFFAOYSA-N
SMILES:C(=NN=C(C(F)(F)F)F)(C(F)(F)F)F
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2,2,2-Trifluoro-N-(1,2,2,2-tetrafluoroethylidene)ethanehydrazonoyl fluoride
CAS:2,2,2-Trifluoro-N-(1,2,2,2-tetrafluoroethylidene)ethanehydrazonoyl fluorideFormula:C4F8N2Molecular weight:228.045Ethanehydrazonoyl fluoride, 2,2,2-trifluoro-N-(tetrafluoroethylidene)-
CAS:Formula:C4F8N2Molecular weight:228.0434


