CAS 88580-04-5
:Benzoic acid, 3-(2-oxopropyl)-2-(phenylmethoxy)-, methyl ester
Description:
Benzoic acid, 3-(2-oxopropyl)-2-(phenylmethoxy)-, methyl ester, identified by CAS number 88580-04-5, is an organic compound characterized by its ester functional group and aromatic structure. This compound features a benzoic acid moiety, which contributes to its acidity and potential for forming hydrogen bonds. The presence of the 2-oxopropyl group indicates a ketone functionality, which can influence its reactivity and stability. The phenylmethoxy group enhances its lipophilicity, potentially affecting its solubility in organic solvents. Generally, esters like this compound are known for their pleasant odors and are often used in flavoring and fragrance applications. Additionally, the structure suggests potential applications in pharmaceuticals or agrochemicals due to the presence of both aromatic and aliphatic components. The compound's properties, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the specific arrangement of its substituents. Overall, this compound exemplifies the complexity and versatility of organic esters in various chemical contexts.
Formula:C18H18O4
InChI:InChI=1S/C18H18O4/c1-13(19)11-15-9-6-10-16(18(20)21-2)17(15)22-12-14-7-4-3-5-8-14/h3-10H,11-12H2,1-2H3
InChI key:PELVPDUWRYEICM-UHFFFAOYSA-N
SMILES:CC(=O)CC1=C(C(=CC=C1)C(=O)OC)OCC2=CC=CC=C2
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Benzoic acid, 3-(2-oxopropyl)-2-(phenylmethoxy)-, methyl ester
CAS:Formula:C18H18O4Molecular weight:298.3331
