CymitQuimica logo

CAS 88580-16-9

:

1-Propanone, 1-(2-amino-5-methoxyphenyl)-3-(1-piperidinyl)-

Description:
1-Propanone, 1-(2-amino-5-methoxyphenyl)-3-(1-piperidinyl)-, also known by its CAS number 88580-16-9, is a chemical compound that belongs to the class of ketones and is characterized by its structural features, which include a propanone backbone, an amino group, and a methoxy-substituted phenyl ring. This compound exhibits a range of properties typical of ketones, such as being a polar solvent with potential solubility in various organic solvents. The presence of the piperidine moiety suggests potential biological activity, as piperidine derivatives are often explored for their pharmacological properties. The methoxy group can influence the compound's electronic properties and reactivity, potentially enhancing its lipophilicity. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly in the context of designing new therapeutic agents. However, specific physical and chemical properties such as melting point, boiling point, and spectral data would require experimental determination or literature reference for precise characterization.
Formula:C15H22N2O2
InChI:InChI=1S/C15H22N2O2/c1-19-12-5-6-14(16)13(11-12)15(18)7-10-17-8-3-2-4-9-17/h5-6,11H,2-4,7-10,16H2,1H3
InChI key:XRPCZNFARHEQNG-UHFFFAOYSA-N
SMILES:COC1=CC(=C(C=C1)N)C(=O)CCN2CCCCC2
Found 1 products.