CymitQuimica logo

CAS 88580-34-1

:

Phosphonic acid, 2-(pentadecyloxy)-1,3-propanediyl ester

Description:
Phosphonic acid, 2-(pentadecyloxy)-1,3-propanediyl ester, with the CAS number 88580-34-1, is an organophosphorus compound characterized by its phosphonic acid functional group and a long-chain alkoxy group derived from pentadecanol. This compound typically exhibits properties associated with phosphonic acids, such as being a strong acid and having the ability to form stable complexes with metal ions. The presence of the long pentadecyloxy chain contributes to its hydrophobic characteristics, which can enhance its solubility in organic solvents while limiting its solubility in water. This amphiphilic nature may allow it to function effectively as a surfactant or emulsifier in various applications. Additionally, the ester functionality suggests potential reactivity, making it useful in chemical synthesis or as a precursor in the production of other phosphonic acid derivatives. Overall, this compound's unique structure imparts specific physical and chemical properties that can be exploited in industrial and research applications, particularly in fields such as agriculture, materials science, and pharmaceuticals.
Formula:C18H40O7P2
InChI:InChI=1S/C18H36O4P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-20-18-16-21-23(19)22-17-18/h18H,2-17H2,1H3/q+1
InChI key:YTSRVKCCKVNDHW-UHFFFAOYSA-N
SMILES:CCCCCCCCCCCCCCCOC1CO[P+](=O)OC1
Found 1 products.