CAS 88580-64-7
:Benzene, 1,3,5-trichloro-2-(2,6-dichloro-4-nitrophenoxy)-4-nitro-
Description:
Benzene, 1,3,5-trichloro-2-(2,6-dichloro-4-nitrophenoxy)-4-nitro- is a chlorinated aromatic compound characterized by the presence of multiple chlorine and nitro functional groups attached to a benzene ring. This compound features a complex structure with three chlorine atoms and two nitro groups, which contribute to its chemical reactivity and potential applications in various fields, including agriculture as a pesticide or herbicide. The presence of the nitro groups indicates that it may exhibit significant electron-withdrawing properties, influencing its reactivity and interactions with other chemical species. Additionally, the chlorinated nature of the compound suggests that it may have hydrophobic characteristics, affecting its solubility in different solvents. Safety considerations are paramount when handling such compounds, as they may pose environmental and health risks due to their potential toxicity and persistence in the environment. Proper storage, handling, and disposal methods should be employed to mitigate any hazards associated with this chemical.
Formula:C12H3Cl5N2O5
InChI:InChI=1S/C12H3Cl5N2O5/c13-5-3-8(16)12(9(17)10(5)19(22)23)24-11-6(14)1-4(18(20)21)2-7(11)15/h1-3H
InChI key:LFADPGKYKPNWPD-UHFFFAOYSA-N
SMILES:C1=C(C=C(C(=C1Cl)OC2=C(C=C(C(=C2Cl)[N+](=O)[O-])Cl)Cl)Cl)[N+](=O)[O-]
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Benzene, 1,3,5-trichloro-2-(2,6-dichloro-4-nitrophenoxy)-4-nitro-
CAS:Formula:C12H3Cl5N2O5Molecular weight:432.4276
