CAS 88581-12-8
:Naphthalene, 3-nitro-1-[(trifluoromethyl)thio]-
Description:
Naphthalene, 3-nitro-1-[(trifluoromethyl)thio]- (CAS 88581-12-8) is an organic compound characterized by its complex structure, which includes a naphthalene ring substituted with a nitro group and a trifluoromethylthio group. This compound typically exhibits a solid state at room temperature and is known for its aromatic properties due to the presence of the naphthalene moiety. The nitro group contributes to its reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitution. The trifluoromethylthio group enhances its lipophilicity and may influence its biological activity, making it of interest in fields such as agrochemicals and pharmaceuticals. Naphthalene derivatives often display unique physical properties, such as melting and boiling points that can vary significantly based on the substituents. Additionally, this compound may exhibit toxicity and environmental persistence, necessitating careful handling and consideration in applications. Overall, its unique structural features and functional groups make it a subject of interest in synthetic organic chemistry and material science.
Formula:C11H6F3NO2S
InChI:InChI=1S/C11H6F3NO2S/c12-11(13,14)18-10-6-8(15(16)17)5-7-3-1-2-4-9(7)10/h1-6H
InChI key:RBUGMECAWPLDNV-UHFFFAOYSA-N
SMILES:C1=CC=C2C(=C1)C=C(C=C2SC(F)(F)F)[N+](=O)[O-]
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
