CymitQuimica logo

CAS 88582-00-7

:

Ethenol, 2-(4-morpholinyl)-2-(naphthalenyl)-

Description:
Ethenol, 2-(4-morpholinyl)-2-(naphthalenyl)-, also known by its CAS number 88582-00-7, is an organic compound characterized by its unique structural features, which include a naphthalene moiety and a morpholine ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential applications in various fields, including pharmaceuticals and materials science. The presence of the morpholine group suggests that it may possess basic properties, while the naphthalene component can impart hydrophobic characteristics. Ethenol derivatives often display reactivity due to the presence of the ethenol functional group, which can participate in various chemical reactions, such as polymerization or condensation. Additionally, the compound may exhibit specific solubility characteristics, depending on the solvent used, and could show biological activity, making it of interest for medicinal chemistry. Overall, the combination of these structural elements suggests a compound with diverse potential applications and interesting chemical behavior.
Formula:C16H17NO2
InChI:InChI=1S/C16H17NO2/c18-12-16(17-8-10-19-11-9-17)15-7-3-5-13-4-1-2-6-14(13)15/h1-7,12,18H,8-11H2
InChI key:RZPDVKQDVADHMK-UHFFFAOYSA-N
SMILES:C1COCCN1C(=CO)C2=CC=CC3=CC=CC=C32
Found 1 products.