CymitQuimica logo

CAS 88584-32-1

:

Isoxazolo[4,5-b]pyridine, 4,5-dihydro-3-methyl-5,6-diphenyl-

Description:
Isoxazolo[4,5-b]pyridine, 4,5-dihydro-3-methyl-5,6-diphenyl- is a heterocyclic compound characterized by its unique bicyclic structure that incorporates both isoxazole and pyridine moieties. This compound typically exhibits a fused ring system, which contributes to its chemical stability and potential biological activity. The presence of the methyl group and diphenyl substituents enhances its lipophilicity, potentially influencing its solubility and interaction with biological targets. Isoxazolo[4,5-b]pyridine derivatives are of interest in medicinal chemistry due to their diverse pharmacological properties, including anti-inflammatory and anticancer activities. The compound's reactivity can be attributed to the electron-rich nature of the isoxazole ring, making it a candidate for various chemical transformations. Additionally, its structural features may allow for the formation of hydrogen bonds and other non-covalent interactions, which are crucial in drug design and development. Overall, this compound represents a significant area of research in the synthesis of novel therapeutic agents.
Formula:C19H16N2O
InChI:InChI=1S/C19H16N2O/c1-13-18-17(22-21-13)12-16(14-8-4-2-5-9-14)19(20-18)15-10-6-3-7-11-15/h2-12,19-20H,1H3
InChI key:BCOHBXCVXCHNPG-UHFFFAOYSA-N
SMILES:CC1=NOC2=C1NC(C(=C2)C3=CC=CC=C3)C4=CC=CC=C4
Found 1 products.