CymitQuimica logo

CAS 88584-98-9

:

Phosphonic acid, [3-(acetyloxy)propyl]-, dibutyl ester

Description:
Phosphonic acid, [3-(acetyloxy)propyl]-, dibutyl ester, with the CAS number 88584-98-9, is an organophosphorus compound characterized by its phosphonic acid functional group esterified with dibutyl alcohol and an acetyloxypropyl moiety. This compound typically exhibits properties such as being a colorless to pale yellow liquid with a moderate viscosity. It is soluble in organic solvents, which makes it useful in various applications, including as a surfactant or emulsifier in formulations. The presence of the phosphonic acid group imparts potential reactivity, particularly in forming complexes with metal ions, which can be advantageous in agricultural or industrial applications. Additionally, the acetyloxy group may enhance its stability and solubility in certain environments. Safety data should be consulted, as organophosphorus compounds can exhibit varying degrees of toxicity and environmental impact. Overall, this compound's unique structure and functional groups contribute to its utility in chemical synthesis and formulation chemistry.
Formula:C13H27O5P
InChI:InChI=1S/C13H27O5P/c1-4-6-10-17-19(15,18-11-7-5-2)12-8-9-16-13(3)14/h4-12H2,1-3H3
InChI key:PGGIXPOXFAFKPW-UHFFFAOYSA-N
SMILES:CCCCOP(=O)(CCCOC(=O)C)OCCCC
Found 1 products.