CymitQuimica logo

CAS 88589-63-3

:

Cyclohexanone, 2-chloro-, oxime, (E)-

Description:
Cyclohexanone, 2-chloro-, oxime, (E)- is an organic compound characterized by the presence of a cyclohexanone ring with a chloro substituent and an oxime functional group. The (E)- configuration indicates that the oxime group is oriented in a specific geometric arrangement relative to the cyclohexanone structure. This compound typically exhibits a moderate polarity due to the presence of the oxime functional group, which can participate in hydrogen bonding. It is generally a colorless to pale yellow liquid with a distinctive odor. Cyclohexanone derivatives are often used in organic synthesis and can serve as intermediates in the production of various chemicals, including pharmaceuticals and agrochemicals. The presence of the chlorine atom may impart unique reactivity, making it useful in further chemical transformations. Safety data should be consulted, as halogenated compounds can pose health risks, including toxicity and environmental concerns. Proper handling and storage conditions are essential to ensure safety when working with this compound.
Formula:C6H10ClNO
InChI:InChI=1S/C6H10ClNO/c7-5-3-1-2-4-6(5)8-9/h5,9H,1-4H2/b8-6+
InChI key:ODCQZCNSWWLGCQ-SOFGYWHQSA-N
SMILES:C1CC/C(=N\O)/C(C1)Cl
Found 1 products.