CymitQuimica logo

CAS 88593-63-9

:

Pyridine, 1,2,3,6-tetrahydro-5-(3-methoxyphenyl)-

Description:
Pyridine, 1,2,3,6-tetrahydro-5-(3-methoxyphenyl)-, identified by CAS number 88593-63-9, is a heterocyclic organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This specific compound features a tetrahydro configuration, indicating that it has undergone partial hydrogenation, resulting in a saturated form of the pyridine ring. The presence of a 3-methoxyphenyl substituent enhances its chemical properties, potentially influencing its reactivity and solubility. Generally, compounds of this nature exhibit moderate polarity due to the presence of both aromatic and aliphatic components, which can affect their interactions with solvents and other chemical species. Pyridine derivatives are often utilized in various applications, including pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The specific characteristics, such as melting point, boiling point, and solubility, would depend on the compound's molecular structure and functional groups, which can significantly influence its behavior in chemical reactions and applications.
Formula:C12H15NO
InChI:InChI=1S/C12H15NO/c1-14-12-6-2-4-10(8-12)11-5-3-7-13-9-11/h2,4-6,8,13H,3,7,9H2,1H3
InChI key:YHOOHZTUBROZFM-UHFFFAOYSA-N
SMILES:COC1=CC=CC(=C1)C2=CCCNC2
Found 1 products.