CymitQuimica logo

CAS 88593-94-6

:

4(1H)-Pyrimidinone, 5-methoxy-2-[2-(methylthio)ethyl]-

Description:
4(1H)-Pyrimidinone, 5-methoxy-2-[2-(methylthio)ethyl]- is a chemical compound characterized by its pyrimidinone core structure, which features a six-membered aromatic ring containing nitrogen atoms. The presence of a methoxy group at the 5-position and a 2-(methylthio)ethyl side chain at the 2-position contributes to its unique chemical properties. This compound is typically classified as an organic heterocyclic compound, and its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The methylthio group may enhance lipophilicity, potentially influencing the compound's bioavailability and interaction with biological targets. Additionally, the compound's stability and reactivity can be influenced by the functional groups present, making it a subject of interest for further research in synthetic chemistry and drug design. As with many pyrimidine derivatives, it may exhibit various biological activities, warranting investigation into its pharmacological properties.
Formula:C8H12N2O2S
InChI:InChI=1S/C8H12N2O2S/c1-12-6-5-9-7(3-4-13-2)10-8(6)11/h5H,3-4H2,1-2H3,(H,9,10,11)
InChI key:YCBXZHLHPHPGDJ-UHFFFAOYSA-N
SMILES:COC1=CN=C(NC1=O)CCSC
Found 1 products.