CAS 88594-65-4
:Pyrimidine, 2-[(4-pyridinylmethyl)thio]-
Description:
Pyrimidine, 2-[(4-pyridinylmethyl)thio]- is a heterocyclic organic compound characterized by the presence of a pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features a thioether functional group, where a sulfur atom is bonded to a methyl group that is further connected to a 4-pyridinyl moiety, enhancing its potential for biological activity. The presence of both pyrimidine and pyridine rings suggests that this compound may exhibit interesting electronic properties and reactivity, making it a candidate for various applications in medicinal chemistry and material science. Its structure may influence its solubility, stability, and interaction with biological targets. Additionally, the compound's CAS number, 88594-65-4, allows for easy identification and reference in chemical databases. Overall, this compound's unique structural features contribute to its potential utility in research and development within the fields of pharmaceuticals and agrochemicals.
Formula:C10H9N3S
InChI:InChI=1S/C10H9N3S/c1-4-12-10(13-5-1)14-8-9-2-6-11-7-3-9/h1-7H,8H2
InChI key:WFFIXZNLHHUGAV-UHFFFAOYSA-N
SMILES:C1=CN=C(N=C1)SCC2=CC=NC=C2
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
