CymitQuimica logo

CAS 88594-67-6

:

Pyridine, 3-[[(4-chlorophenyl)thio]methyl]-

Description:
Pyridine, 3-[[(4-chlorophenyl)thio]methyl]- is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a thioether functional group, specifically a chlorophenyl thioether, contributes to its chemical reactivity and potential applications. The compound features a 4-chlorophenyl group attached to a sulfur atom, which is further linked to a methyl group that connects to the pyridine nitrogen at the 3-position. This structural arrangement imparts unique properties, such as increased lipophilicity and potential biological activity. Pyridine derivatives are often utilized in pharmaceuticals, agrochemicals, and as solvents or intermediates in organic synthesis. The compound's specific characteristics, including its solubility, melting point, and reactivity, would depend on the surrounding conditions and the presence of other functional groups. Safety data should be consulted for handling and storage, as compounds containing chlorine and sulfur can pose health and environmental risks.
Formula:C12H10ClNS
InChI:InChI=1S/C12H10ClNS/c13-11-3-5-12(6-4-11)15-9-10-2-1-7-14-8-10/h1-8H,9H2
InChI key:NVXYSVDAIVLSLO-UHFFFAOYSA-N
SMILES:C1=CC(=CN=C1)CSC2=CC=C(C=C2)Cl
Found 1 products.