CAS 88594-83-6
:Benzoic acid, 4-(5-cyano-1,6-dihydro-2-methyl-6-oxo-3-pyridinyl)-
Description:
Benzoic acid, 4-(5-cyano-1,6-dihydro-2-methyl-6-oxo-3-pyridinyl)-, is a chemical compound characterized by its benzoic acid core structure, which is a carboxylic acid featuring a benzene ring. The presence of the 5-cyano-1,6-dihydro-2-methyl-6-oxo-3-pyridinyl substituent indicates that it has a pyridine ring with various functional groups, including a cyano group and a ketone, contributing to its unique reactivity and properties. This compound is likely to exhibit moderate solubility in organic solvents and may have limited solubility in water due to the hydrophobic nature of the aromatic ring. Its structure suggests potential applications in pharmaceuticals or agrochemicals, as derivatives of benzoic acid are often utilized for their biological activity. Additionally, the presence of the cyano group may impart specific electronic properties, influencing its reactivity in chemical reactions. Overall, this compound's characteristics make it of interest in various fields of chemical research and application.
Formula:C14H10N2O3
InChI:InChI=1S/C14H10N2O3/c1-8-12(6-11(7-15)13(17)16-8)9-2-4-10(5-3-9)14(18)19/h2-6H,1H3,(H,16,17)(H,18,19)
InChI key:WKPWSXPVVJTWAR-UHFFFAOYSA-N
SMILES:CC1=C(C=C(C(=O)N1)C#N)C2=CC=C(C=C2)C(=O)O
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Benzoic acid, 4-(5-cyano-1,6-dihydro-2-methyl-6-oxo-3-pyridinyl)-
CAS:Formula:C14H10N2O3Molecular weight:254.2408
