CymitQuimica logo

CAS 885949-84-8

:

1-[3-Chloro-4-[(3-methoxyphenyl)methoxy]phenyl]ethanone

Description:
1-[3-Chloro-4-[(3-methoxyphenyl)methoxy]phenyl]ethanone, with the CAS number 885949-84-8, is an organic compound characterized by its complex molecular structure, which includes a chloro substituent and methoxy groups. This compound features a ketone functional group, indicated by the ethanone moiety, which contributes to its reactivity and potential applications in organic synthesis. The presence of the chloro group enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. The methoxyphenyl groups provide additional steric and electronic effects, influencing the compound's solubility and reactivity. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The specific properties, such as melting point, boiling point, and solubility, would depend on the compound's purity and the conditions under which it is studied. Overall, this compound represents a versatile building block in organic synthesis and may have potential applications in pharmaceuticals or agrochemicals.
Formula:C16H15ClO3
InChI:InChI=1S/C16H15ClO3/c1-11(18)13-6-7-16(15(17)9-13)20-10-12-4-3-5-14(8-12)19-2/h3-9H,10H2,1-2H3
InChI key:InChIKey=ZLFIQUARIGKWCD-UHFFFAOYSA-N
SMILES:O(CC1=CC(OC)=CC=C1)C2=C(Cl)C=C(C(C)=O)C=C2
Synonyms:
  • 1-[3-Chloro-4-[(3-methoxyphenyl)methoxy]phenyl]ethanone
  • Ethanone, 1-[3-chloro-4-[(3-methoxyphenyl)methoxy]phenyl]-
Found 1 products.