CAS 88595-27-1
:1H-Pyrrole-2,5-dione, 1-(4-mercaptophenyl)-3,4-dimethyl-
Description:
1H-Pyrrole-2,5-dione, 1-(4-mercaptophenyl)-3,4-dimethyl- is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features a dione functional group, indicating the presence of two carbonyl (C=O) groups, and a thiol group (-SH) attached to a phenyl ring, which contributes to its reactivity and potential applications in various fields. The presence of methyl groups at the 3 and 4 positions of the pyrrole ring enhances its hydrophobic character and may influence its biological activity. This compound may exhibit interesting properties such as antioxidant activity, making it of interest in medicinal chemistry and materials science. Its unique structure allows for potential interactions with biological systems, which could be explored for therapeutic applications. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its chemical properties.
Formula:C12H11NO2S
InChI:InChI=1S/C12H11NO2S/c1-7-8(2)12(15)13(11(7)14)9-3-5-10(16)6-4-9/h3-6,16H,1-2H3
InChI key:KSYJHPLFKDICOC-UHFFFAOYSA-N
SMILES:CC1=C(C(=O)N(C1=O)C2=CC=C(C=C2)S)C
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1H-Pyrrole-2,5-dione, 1-(4-mercaptophenyl)-3,4-dimethyl-
CAS:Formula:C12H11NO2SMolecular weight:233.2862
