CymitQuimica logo

CAS 88595-29-3

:

1H-Pyrrole-2,5-dione, 1-(2-mercaptoethyl)-3,4-dimethyl-

Description:
1H-Pyrrole-2,5-dione, 1-(2-mercaptoethyl)-3,4-dimethyl- is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic ring containing nitrogen. This compound features a dione functional group, indicating the presence of two carbonyl (C=O) groups, and a mercaptoethyl side chain, which introduces a thiol (-SH) group, enhancing its reactivity and potential for forming disulfide bonds. The presence of two methyl groups at the 3 and 4 positions of the pyrrole ring contributes to its hydrophobic character and may influence its biological activity. This compound may exhibit various properties such as antioxidant activity, making it of interest in medicinal chemistry and materials science. Its CAS number, 88595-29-3, allows for easy identification and retrieval of information in chemical databases. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other substances.
Formula:C8H11NO2S
InChI:InChI=1S/C8H11NO2S/c1-5-6(2)8(11)9(3-4-12)7(5)10/h12H,3-4H2,1-2H3
InChI key:KVVMTGGCEQVCMM-UHFFFAOYSA-N
SMILES:CC1=C(C(=O)N(C1=O)CCS)C
Found 1 products.